| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:14:11 UTC |
|---|
| Update Date | 2020-05-11 20:54:21 UTC |
|---|
| BMDB ID | BMDB0004974 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Glucosylceramide (d18:1/22:0) |
|---|
| Description | Glucosylceramide (d18:1/22:0), also known as beta-glucosylceramide or beta-glccer, belongs to the class of organic compounds known as glycosyl-n-acylsphingosines. Glycosyl-N-acylsphingosines are compounds containing a sphingosine linked to a simple glucosyl moiety. Glucosylceramide (d18:1/22:0) is an extremely weak basic (essentially neutral) compound (based on its pKa). |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| beta-D-Glucopyranosyl-N-(docosanoyl)sphingosine | ChEBI | | beta-D-Glucosyl-N-(behenoyl)sphingosine | ChEBI | | beta-D-Glucosyl-N-docosanoylsphingosine | ChEBI | | beta-GlcCer | ChEBI | | beta-Glucosylceramide | ChEBI | | C22 GlcCer | ChEBI | | CMH | ChEBI | | GlcCer(D18:1/22:0) | ChEBI | | N-(Docosanoyl)-1-beta-glucosyl-sphing-4-enine | ChEBI | | b-D-Glucopyranosyl-N-(docosanoyl)sphingosine | Generator | | Β-D-glucopyranosyl-N-(docosanoyl)sphingosine | Generator | | b-D-Glucosyl-N-(behenoyl)sphingosine | Generator | | Β-D-glucosyl-N-(behenoyl)sphingosine | Generator | | b-D-Glucosyl-N-docosanoylsphingosine | Generator | | Β-D-glucosyl-N-docosanoylsphingosine | Generator | | b-GlcCer | Generator | | Β-glccer | Generator | | b-Glucosylceramide | Generator | | Β-glucosylceramide | Generator | | N-(Docosanoyl)-1-b-glucosyl-sphing-4-enine | Generator | | N-(Docosanoyl)-1-β-glucosyl-sphing-4-enine | Generator | | b-D-Glucosyl-N-(docosanoyl)sphingosine | HMDB | | Β-D-glucosyl-N-(docosanoyl)sphingosine | HMDB | | 1-O-b-D-Glucopyranosyl-ceramide | HMDB | | 1-O-beta-delta-Glucopyranosyl-ceramide | HMDB | | Ganglioside GL1a | HMDB | | Gaucher cerebroside | HMDB | | GLC-beta1->1'cer | HMDB | | GlcCeramide | HMDB | | Glucocerebroside | HMDB | | Glucosylceramide | HMDB | | Glucosylceramide (D18:1/22:0) | ChEBI |
|
|---|
| Chemical Formula | C46H89NO8 |
|---|
| Average Molecular Weight | 784.2008 |
|---|
| Monoisotopic Molecular Weight | 783.658818829 |
|---|
| IUPAC Name | N-[(2S,3R,4E)-3-hydroxy-1-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}octadec-4-en-2-yl]docosanamide |
|---|
| Traditional Name | CMH |
|---|
| CAS Registry Number | 85305-87-9 |
|---|
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)\C=C\CCCCCCCCCCCCC |
|---|
| InChI Identifier | InChI=1S/C46H89NO8/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-34-36-42(50)47-39(38-54-46-45(53)44(52)43(51)41(37-48)55-46)40(49)35-33-31-29-27-25-23-16-14-12-10-8-6-4-2/h33,35,39-41,43-46,48-49,51-53H,3-32,34,36-38H2,1-2H3,(H,47,50)/b35-33+/t39-,40+,41+,43+,44-,45+,46+/m0/s1 |
|---|
| InChI Key | YIGARKIIFOHVPF-CNUVFPMCSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as glycosyl-n-acylsphingosines. Glycosyl-N-acylsphingosines are compounds containing a sphingosine linked to a simple glucosyl moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Sphingolipids |
|---|
| Sub Class | Glycosphingolipids |
|---|
| Direct Parent | Glycosyl-N-acylsphingosines |
|---|
| Alternative Parents | |
|---|
| Substituents | - Glycosyl-n-acylsphingosine
- Fatty acyl glycoside
- Fatty acyl glycoside of mono- or disaccharide
- Alkyl glycoside
- Hexose monosaccharide
- Glycosyl compound
- O-glycosyl compound
- Fatty amide
- Fatty acyl
- Monosaccharide
- N-acyl-amine
- Oxane
- Carboxamide group
- Secondary carboxylic acid amide
- Secondary alcohol
- Acetal
- Carboxylic acid derivative
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Alcohol
- Organic oxygen compound
- Organic nitrogen compound
- Primary alcohol
- Carbonyl group
- Organooxygen compound
- Organonitrogen compound
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cell membrane
- Endosome
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Insoluble | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|