| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:38:49 UTC |
|---|
| Update Date | 2020-05-21 16:26:58 UTC |
|---|
| BMDB ID | BMDB0000935 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Uridine diphosphate glucuronic acid |
|---|
| Description | Uridine diphosphate glucuronic acid, also known as udpglucuronate or UDP-a-D-glucuronic acid, belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Uridine diphosphate glucuronic acid is an extremely weak basic (essentially neutral) compound (based on its pKa). Uridine diphosphate glucuronic acid exists in all living species, ranging from bacteria to humans. Within cattle, uridine diphosphate glucuronic acid participates in a number of enzymatic reactions. In particular, 2-methoxyestrone and uridine diphosphate glucuronic acid can be converted into 2-methoxyestrone 3-glucuronide and uridine 5'-diphosphate through the action of the enzyme UDP-glucuronosyltransferase 1-1. In addition, estrone and uridine diphosphate glucuronic acid can be converted into estrone glucuronide and uridine 5'-diphosphate; which is mediated by the enzyme UDP-glucuronosyltransferase 1-1. In cattle, uridine diphosphate glucuronic acid is involved in the metabolic pathway called the estrone metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| UDP-alpha-D-Glucuronate | ChEBI | | UDP-D-Glucuronate | ChEBI | | UDP-Glucuronate | ChEBI | | UDPglucuronate | ChEBI | | URIDINE-5'-diphosphATE-glucuronIC ACID | ChEBI | | UDP-a-D-Glucuronate | Generator | | UDP-a-D-Glucuronic acid | Generator | | UDP-alpha-D-Glucuronic acid | Generator | | UDP-Α-D-glucuronate | Generator | | UDP-Α-D-glucuronic acid | Generator | | UDP-D-Glucuronic acid | Generator | | UDP-Glucuronic acid | Generator | | UDPglucuronic acid | Generator | | URIDINE-5'-diphosphate-glucuronate | Generator | | URIDINE-5'-diphosphoric acid-glucuronic acid | Generator | | Uridine diphosphate glucuronate | Generator | | Uridine diphosphoric acid glucuronic acid | Generator | | a-D-Glucopyranuronic acid 1->5'-ester with uridine 5'-(trihydrogen pyrophosphate) | HMDB | | a-D-Glucopyranuronic acid ester with uridine 5'-pyrophosphate | HMDB | | alpha-D-Glucopyranuronic acid 1-p'-ester with uridine 5'-(trihydrogen diphosphate) | HMDB | | alpha-delta-Glucopyranuronic acid 1->5'-ester with uridine 5'-(trihydrogen pyrophosphate) | HMDB | | alpha-delta-Glucopyranuronic acid 1-p'-ester with uridine 5'-(trihydrogen diphosphate) | HMDB | | alpha-delta-Glucopyranuronic acid ester with uridine 5'-pyrophosphate | HMDB | | Glucopyranuronic acid 1-ester with uridine 5'-pyrophosphate | HMDB | | UDP Glucuronate | HMDB | | UDP Glucuronic acid | HMDB | | UDP-alpha-delta-Glucuronate | HMDB | | UDP-delta-Glucuronate | HMDB | | UDP-delta-Glucuronic acid | HMDB | | UDP-GlcUA | HMDB | | UDPGA | HMDB | | UGA | HMDB | | Uridine 5'-diphospho-a-D-glucuronate | HMDB | | Uridine 5'-diphospho-a-D-glucuronic acid | HMDB | | Uridine 5'-diphospho-alpha-delta-glucuronate | HMDB | | Uridine 5'-diphospho-alpha-delta-glucuronic acid | HMDB | | Uridine 5'-diphospho-glucuronic acid | HMDB | | Uridine 5'-diphosphoglucuronate | HMDB | | Uridine 5'-diphosphoglucuronic acid | HMDB | | Uridine 5'-[3-(D-glucopyranosyloxyuronic acid) dihydrogen diphosphate] | HMDB | | Uridine diphosphate-glucuronate | HMDB | | Uridine diphospho-D-glucuronate | HMDB | | Uridine diphospho-D-glucuronic acid | HMDB | | Uridine diphospho-delta-glucuronate | HMDB | | Uridine diphospho-delta-glucuronic acid | HMDB | | Uridine diphosphoglucuronate | HMDB | | Uridine diphosphoglucuronic acid | HMDB | | Uridine pyrophosphoglucuronate | HMDB | | Uridine pyrophosphoglucuronic acid | HMDB | | Uridinediphosphoglucuronic acid | HMDB | | Acid, UDP glucuronic | HMDB | | Acid, uridine diphosphoglucuronic | HMDB | | Glucuronic acid, UDP | HMDB | | Diphosphoglucuronic acid, uridine | HMDB | | Uridine 5'-diphospho-alpha-D-glucuronic acid | HMDB | | Uridine 5'-diphospho-α-D-glucuronic acid | HMDB | | Uridine 5’-diphospho-α-D-glucuronic acid | HMDB | | Uridine 5’-diphosphoglucuronic acid | HMDB | | Uridine diphosphate glucuronic acid | HMDB |
|
|---|
| Chemical Formula | C15H22N2O18P2 |
|---|
| Average Molecular Weight | 580.2853 |
|---|
| Monoisotopic Molecular Weight | 580.034284934 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6R)-6-({[({[(2R,3S,4R,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Traditional Name | udp-α-D-glucuronic acid |
|---|
| CAS Registry Number | 2616-64-0 |
|---|
| SMILES | O[C@@H]1[C@@H](COP(O)(=O)OP(O)(=O)O[C@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)O[C@H]([C@@H]1O)N1C=CC(=O)NC1=O |
|---|
| InChI Identifier | InChI=1S/C15H22N2O18P2/c18-5-1-2-17(15(26)16-5)12-9(22)6(19)4(32-12)3-31-36(27,28)35-37(29,30)34-14-10(23)7(20)8(21)11(33-14)13(24)25/h1-2,4,6-12,14,19-23H,3H2,(H,24,25)(H,27,28)(H,29,30)(H,16,18,26)/t4-,6-,7+,8+,9-,10-,11+,12-,14-/m1/s1 |
|---|
| InChI Key | HDYANYHVCAPMJV-LXQIFKJMSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Lactones |
|---|
| Sub Class | Gamma butyrolactones |
|---|
| Direct Parent | Gamma butyrolactones |
|---|
| Alternative Parents | |
|---|
| Substituents | - Gamma butyrolactone
- Tetrahydrofuran
- Secondary alcohol
- Carboxylic acid ester
- 1,2-diol
- Oxacycle
- Monocarboxylic acid or derivatives
- Carboxylic acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Carbonyl group
- Alcohol
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cytoplasm
- Endoplasmic reticulum
- Golgi
- Mitochondria
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
| Synthesis Reference | Simon, Ethan S.; Grabowski, Sven; Whitesides, George M. Convenient syntheses of cytidine 5'-triphosphate, guanosine 5'-triphosphate, and uridine 5'-triphosphate and their use in the preparation of UDP-glucose, UDP-glucuronic acid, and GDP-mannose. J. Org. Chem., 1990, 55 (6), pp 1834–1841 DOI: 10.1021/jo00293a030 |
|---|