| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:35:25 UTC |
|---|
| Update Date | 2020-05-11 20:09:08 UTC |
|---|
| BMDB ID | BMDB0000717 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Isolithocholic acid |
|---|
| Description | Isolithocholic acid, also known as 3-epilithocholate or beta-lithocholanate, belongs to the class of organic compounds known as monohydroxy bile acids, alcohols and derivatives. These are bile acids, alcohols or any of their derivatives bearing a hydroxyl group. Based on a literature review a significant number of articles have been published on Isolithocholic acid. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (3beta,5beta)-3-Hydroxycholan-24-Oic acid | ChEBI | | 3-Epilithocholic acid | ChEBI | | 3beta-Hydroxy-5beta-cholan-24-Oic acid | ChEBI | | 3beta-Lithocholic acid | ChEBI | | beta-Lithocholanic acid | ChEBI | | beta-Lithocholic acid | ChEBI | | (3b,5b)-3-Hydroxycholan-24-Oate | Generator | | (3b,5b)-3-Hydroxycholan-24-Oic acid | Generator | | (3beta,5beta)-3-Hydroxycholan-24-Oate | Generator | | (3Β,5β)-3-hydroxycholan-24-Oate | Generator | | (3Β,5β)-3-hydroxycholan-24-Oic acid | Generator | | 3-Epilithocholate | Generator | | 3b-Hydroxy-5b-cholan-24-Oate | Generator | | 3b-Hydroxy-5b-cholan-24-Oic acid | Generator | | 3beta-Hydroxy-5beta-cholan-24-Oate | Generator | | 3Β-hydroxy-5β-cholan-24-Oate | Generator | | 3Β-hydroxy-5β-cholan-24-Oic acid | Generator | | 3b-Lithocholate | Generator | | 3b-Lithocholic acid | Generator | | 3beta-Lithocholate | Generator | | 3Β-lithocholate | Generator | | 3Β-lithocholic acid | Generator | | b-Lithocholanate | Generator | | b-Lithocholanic acid | Generator | | beta-Lithocholanate | Generator | | Β-lithocholanate | Generator | | Β-lithocholanic acid | Generator | | b-Lithocholate | Generator | | b-Lithocholic acid | Generator | | beta-Lithocholate | Generator | | Β-lithocholate | Generator | | Β-lithocholic acid | Generator | | Isolithocholate | Generator | | 3b-Hydroxy-5b-cholanate | HMDB | | 3b-Hydroxy-5b-cholanic acid | HMDB | | 3b-Hydroxy-5b-cholanoate | HMDB | | 3b-Hydroxy-5b-cholanoic acid | HMDB | | 5b-Cholanic acid-3b-ol | HMDB | | Acid, isolithocholic | HMDB | | Acid, lithocholic | HMDB | | Lithocholate | HMDB | | Lithocholic acid | HMDB |
|
|---|
| Chemical Formula | C24H40O3 |
|---|
| Average Molecular Weight | 376.5726 |
|---|
| Monoisotopic Molecular Weight | 376.297745146 |
|---|
| IUPAC Name | (4R)-4-[(1S,2S,5S,7R,10R,11S,14R,15R)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanoic acid |
|---|
| Traditional Name | (4R)-4-[(1S,2S,5S,7R,10R,11S,14R,15R)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanoic acid |
|---|
| CAS Registry Number | 1534-35-6 |
|---|
| SMILES | [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@@H](O)CC[C@]12C |
|---|
| InChI Identifier | InChI=1S/C24H40O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-21,25H,4-14H2,1-3H3,(H,26,27)/t15-,16-,17+,18+,19-,20+,21+,23+,24-/m1/s1 |
|---|
| InChI Key | SMEROWZSTRWXGI-WFVDQZAMSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as monohydroxy bile acids, alcohols and derivatives. These are bile acids, alcohols or any of their derivatives bearing a hydroxyl group. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Bile acids, alcohols and derivatives |
|---|
| Direct Parent | Monohydroxy bile acids, alcohols and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Monohydroxy bile acid, alcohol, or derivatives
- 3-hydroxysteroid
- Hydroxysteroid
- 3-beta-hydroxysteroid
- Cyclic alcohol
- Secondary alcohol
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Organic oxide
- Alcohol
- Organic oxygen compound
- Carbonyl group
- Hydrocarbon derivative
- Organooxygen compound
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
| Synthesis Reference | Radominska-Pyrek, Anna; Huynh, Triet; Lester, Roger; St. Pyrek, Jan. Preparation and characterization of 3-monohydroxylated bile acids of different side chain length and configuration at C-3. Novel approach to the synthesis of 24-norlithocholic acid. Journal of Lipid Research (1986), 27(1), 102-13. |
|---|
