| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:33:07 UTC |
|---|
| Update Date | 2020-05-11 20:55:03 UTC |
|---|
| BMDB ID | BMDB0000580 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Chondroitin sulfate |
|---|
| Description | Chondroitin sulfate, also known as sulfate, chondroitin or blutal, belongs to the class of organic compounds known as o-glucuronides. These are glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond. Chondroitin sulfate is an extremely weak basic (essentially neutral) compound (based on its pKa). In cattle, chondroitin sulfate is involved in the metabolic pathway called the sulfate/sulfite metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| Chondroitin sulfuric acid | Generator | | Chondroitin sulphate | Generator | | Chondroitin sulphuric acid | Generator | | Chondritinsulfate | HMDB | | Chondritinsulphate | HMDB | | Chondroitin 6-sulfate | HMDB | | Chondroitin 6-sulphate | HMDB | | Chondroitin polysulfate | HMDB | | Chondroitin polysulphate | HMDB | | Chondroitin sodium sulfate ex shark | HMDB | | Chondroitin sulfate C | HMDB | | Chondroitin sulfate from swine | HMDB | | Chondroitin sulphate C | HMDB | | Chondroitin sulphate from swine | HMDB | | Chondroitinsulfurate | HMDB | | Chondroitinsulfuric acid | HMDB | | Chondroitinsulfuric acids | HMDB | | Blutal | HMDB | | Chondroitin 4 sulfate, aluminum salt | HMDB | | Chondroitin 4-sulfate, aluminum salt | HMDB | | Chondroitin 6 sulfate, potassium salt | HMDB | | Chondroitin 6 sulfate, sodium salt | HMDB | | Chondroitin sulfate a | HMDB | | Sulfate, sodium chondroitin | HMDB | | Chondroitin 4-sulfate, potassium salt | HMDB | | Chondroitin 6-sulfate, potassium salt | HMDB | | Chondroitin sulfate 4 sulfate, sodium salt | HMDB | | Chondroitin sulfate, calcium salt | HMDB | | Chondroitin sulfate, iron (+3) salt | HMDB | | Chondroitin sulfate, iron salt | HMDB | | Chondroitin sulfate, potassium salt | HMDB | | Sulfate, chondroitin | HMDB | | Translagen | HMDB | | Chondroitin 4-sulfate | HMDB | | Chondroitin 6 sulfate | HMDB | | Chondroitin sulfate, sodium | HMDB | | Chondroitin sulfate, sodium salt | HMDB | | Chonsurid | HMDB | | Sulfates, chondroitin | HMDB | | Chondroitin 4 sulfate | HMDB | | Chondroitin 4 sulfate, potassium salt | HMDB | | Chondroitin 6-sulfate, sodium salt | HMDB | | Chondroitin sulfate 4-sulfate, sodium salt | HMDB | | Chondroitin sulfate, zinc salt | HMDB | | Chondroitin sulfates | HMDB | | Sodium chondroitin sulfate | HMDB | | (2S,3S,4S,5R,6R)-6-{[(2R,3R,4R,5R,6R)-2,5-dihydroxy-3-[(1-hydroxyethylidene)amino]-6-(sulfooxy)oxan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylate | HMDB | | (2S,3S,4S,5R,6R)-6-{[(2R,3R,4R,5R,6R)-2,5-dihydroxy-3-[(1-hydroxyethylidene)amino]-6-(sulphooxy)oxan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylate | HMDB | | (2S,3S,4S,5R,6R)-6-{[(2R,3R,4R,5R,6R)-2,5-dihydroxy-3-[(1-hydroxyethylidene)amino]-6-(sulphooxy)oxan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid | HMDB | | Chondroitin sulfate | MeSH |
|
|---|
| Chemical Formula | C13H21NO15S |
|---|
| Average Molecular Weight | 463.369 |
|---|
| Monoisotopic Molecular Weight | 463.063189697 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6R)-6-{[(2R,3R,4R,5R,6R)-3-acetamido-2,5-dihydroxy-6-(sulfooxy)oxan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6R)-6-{[(2R,3R,4R,5R,6R)-3-acetamido-2,5-dihydroxy-6-(sulfooxy)oxan-4-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| CAS Registry Number | 9007-28-7 |
|---|
| SMILES | CC(=O)N[C@H]1[C@H](O)O[C@H](OS(O)(=O)=O)[C@H](O)[C@@H]1O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C13H21NO15S/c1-2(15)14-3-8(7(19)13(28-11(3)22)29-30(23,24)25)26-12-6(18)4(16)5(17)9(27-12)10(20)21/h3-9,11-13,16-19,22H,1H3,(H,14,15)(H,20,21)(H,23,24,25)/t3-,4+,5+,6-,7-,8-,9+,11-,12-,13-/m1/s1 |
|---|
| InChI Key | KXKPYJOVDUMHGS-OSRGNVMNSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as o-glucuronides. These are glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | O-glucuronides |
|---|
| Alternative Parents | |
|---|
| Substituents | - 1-o-glucuronide
- O-glucuronide
- Disaccharide
- Glycosyl compound
- O-glycosyl compound
- Beta-hydroxy acid
- Hydroxy acid
- Oxane
- Pyran
- Sulfuric acid monoester
- Sulfate-ester
- Alkyl sulfate
- Sulfuric acid ester
- Acetamide
- Organic sulfuric acid or derivatives
- Carboxamide group
- Secondary carboxylic acid amide
- Secondary alcohol
- Hemiacetal
- Oxacycle
- Monocarboxylic acid or derivatives
- Acetal
- Carboxylic acid
- Organoheterocyclic compound
- Carboxylic acid derivative
- Polyol
- Hydrocarbon derivative
- Carbonyl group
- Organic oxide
- Organopnictogen compound
- Organic nitrogen compound
- Organonitrogen compound
- Alcohol
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
| Synthesis Reference | Zhang, Wanshan; Yang, Huaying; Zhang, Zhiwu; Qu, Wei; Zhu, Yuehua; Liu, Lanhua; Zeng, Ying; Wan, Cai; Li, Jugen. Extracting chondroitin sulfate from cartilage. Faming Zhuanli Shenqing Gongkai Shuomingshu (2007), 6pp. |
|---|