| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:32:11 UTC |
|---|
| Update Date | 2020-04-21 18:15:29 UTC |
|---|
| BMDB ID | BMDB0000526 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 5a-Tetrahydrocortisol |
|---|
| Description | 5alpha-Tetrahydrocortisol, also known as a-THF or 5ALPHATHF, belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. Thus, 5alpha-tetrahydrocortisol is considered to be a steroid. Based on a literature review a significant number of articles have been published on 5alpha-Tetrahydrocortisol. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 5a-Tetrahydrocortisol | Generator | | 5Α-tetrahydrocortisol | Generator | | 3,11,17,21-Tetrahydroxypregnan-20-one | HMDB | | 3a,11b,17,21-Tetrahydroxy-5a-pregnan-20-one | HMDB | | 3a,11b,17a,21-Tetrahydroxy-5a-pregnan-20-one | HMDB | | 3a,5a-Tetrahydrocortisol | HMDB | | 3a-Allotetrahydrocortisol | HMDB | | 3alpha, 5alpha-Tetrahydrocortisol | HMDB | | 3alpha,5alpha-Tetrahydrocortisol | HMDB | | 5a-Pregnane-3a,11b,17a,21-tetraol-20-one | HMDB | | 5a-Pregnane-3a,11b,17a,21-tetrol-20-one | HMDB | | a-THF | HMDB | | Allo-3a-tetrahydrocortisol | HMDB | | Allo-3alpha-tetrahydrocortisol | HMDB | | Allo-tetrahydrocortisol | HMDB | | Allopregnane-3a,11b,17a,21-tetrol-20-one | HMDB | | Allopregnane-3a,11b,21-tetrol-20-one | HMDB | | Allopregnane-3alpha,11beta,17alpha,21-tetrol-20-one | HMDB | | Allotetrahydro-compound F | HMDB | | Allotetrahydro-cortisol | HMDB | | Allotetrahydrocompound F | HMDB | | Allotetrahydrocortisol | HMDB | | alpha-THF | HMDB | | ATHF | HMDB | | Kendall'S compound c | HMDB | | Reichstein'S substance C | HMDB | | Tetrahydro-allocortisol | HMDB | | Tetrahydroallocortisol | HMDB | | Wintersteiner'S compound D | HMDB | | Allotetrahydrocortisol, (3beta,5alpha,11beta)-isomer | HMDB | | 5AlphaTHF | HMDB | | Allotetrahydrocortisol, (3alpha,5beta,11alpha)-isomer | HMDB | | Allotetrahydrocortisol, (5alpha,11beta)-isomer | HMDB | | Allotetrahydrocortisol, (3beta,5beta,11beta)-isomer | HMDB | | (3alpha,5alpha,11beta)-3,11,17,21-Tetrahydroxypregnan-20-one | HMDB | | (3Α,5α,11β)-3,11,17,21-tetrahydroxypregnan-20-one | HMDB | | 3alpha,11beta,17,21-Tetrahydroxy-5alpha-pregnan-20-one | HMDB | | 3alpha,11beta,17alpha,21-Tetrahydroxy-5alpha-pregnan-20-one | HMDB | | 3Α,11β,17,21-tetrahydroxy-5α-pregnan-20-one | HMDB | | 3Α,11β,17α,21-tetrahydroxy-5α-pregnan-20-one | HMDB | | 3Α,5α-tetrahydrocortisol | HMDB | | 5alpha-Pregnane-3alpha,11beta,17alpha,21-tetraol-20-one | HMDB | | 5alpha-Pregnane-3alpha,11beta,17alpha,21-tetrol-20-one | HMDB | | 5alpha-THF | HMDB | | 5Α-pregnane-3α,11β,17α,21-tetraol-20-one | HMDB | | 5Α-pregnane-3α,11β,17α,21-tetrol-20-one | HMDB | | 5Α-THF | HMDB | | Allopregnane-3α,11β,17α,21-tetrol-20-one | HMDB | | Allo-3α-tetrahydrocortisol | HMDB | | Α-THF | HMDB | | 5alpha-Tetrahydrocortisol | HMDB |
|
|---|
| Chemical Formula | C21H34O5 |
|---|
| Average Molecular Weight | 366.4917 |
|---|
| Monoisotopic Molecular Weight | 366.240624198 |
|---|
| IUPAC Name | 2-hydroxy-1-[(1S,2S,5R,7S,10S,11S,14R,15S,17S)-5,14,17-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]ethan-1-one |
|---|
| Traditional Name | 2-hydroxy-1-[(1S,2S,5R,7S,10S,11S,14R,15S,17S)-5,14,17-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]ethanone |
|---|
| CAS Registry Number | 302-91-0 |
|---|
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@H](O)CC[C@]12C |
|---|
| InChI Identifier | InChI=1S/C21H34O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h12-16,18,22-24,26H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,18+,19-,20-,21-/m0/s1 |
|---|
| InChI Key | AODPIQQILQLWGS-FDSHTENPSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Hydroxysteroids |
|---|
| Direct Parent | 21-hydroxysteroids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Progestogin-skeleton
- 21-hydroxysteroid
- 20-oxosteroid
- Pregnane-skeleton
- 3-hydroxysteroid
- Oxosteroid
- 11-beta-hydroxysteroid
- 11-hydroxysteroid
- 3-alpha-hydroxysteroid
- 17-hydroxysteroid
- Tertiary alcohol
- Alpha-hydroxy ketone
- Cyclic alcohol
- Ketone
- Secondary alcohol
- Polyol
- Primary alcohol
- Alcohol
- Hydrocarbon derivative
- Organooxygen compound
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | - C21 steroids (gluco/mineralocorticoids, progestogins) and derivatives (LMST02030200 )
|
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | Not Available |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cell membrane
- Cytoplasm
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 244.5 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
