| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:30:29 UTC |
|---|
| Update Date | 2020-04-22 15:03:31 UTC |
|---|
| BMDB ID | BMDB0000423 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 3,4-Dihydroxyhydrocinnamic acid |
|---|
| Description | 3,4-Dihydroxyhydrocinnamic acid, also known as 3,4-dihydroxy-b-phenylpropionate or dihydrocaffeic acid, belongs to the class of organic compounds known as phenylpropanoic acids. Phenylpropanoic acids are compounds with a structure containing a benzene ring conjugated to a propanoic acid. 3,4-Dihydroxyhydrocinnamic acid is an extremely weak basic (essentially neutral) compound (based on its pKa). |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 3,4-Dihydroxy-beta-phenylpropionic acid | ChEBI | | 3,4-Dihydroxybenzenepropionic acid | ChEBI | | 3,4-Dihydroxydihydrocinnamic acid | ChEBI | | 3,4-Dihydroxyphenylpropionic acid | ChEBI | | 3-(3,4-Dihydroxyphenyl)propanoate | Kegg | | 3,4-Dihydroxy-b-phenylpropionate | Generator | | 3,4-Dihydroxy-b-phenylpropionic acid | Generator | | 3,4-Dihydroxy-beta-phenylpropionate | Generator | | 3,4-Dihydroxy-β-phenylpropionate | Generator | | 3,4-Dihydroxy-β-phenylpropionic acid | Generator | | 3,4-Dihydroxybenzenepropanoate | Generator | | 3,4-Dihydroxybenzenepropionate | Generator | | 3,4-Dihydroxydihydrocinnamate | Generator | | 3,4-Dihydroxyphenylpropionate | Generator | | 3-(3,4-Dihydroxyphenyl)propionate | Generator | | Dihydrocaffeate | Generator | | Hydrocaffeate | Generator | | 3-(3,4-Dihydroxyphenyl)propanoic acid | Generator | | 3,4-Dihydroxyhydrocinnamate | Generator | | 3,4-Dihydroxy-(6ci,7ci,8ci)hydrocinnamate | HMDB | | 3,4-Dihydroxy-(6ci,7ci,8ci)hydrocinnamic acid | HMDB | | 3,4-Dihydroxyphenylpropionic acid, potassium salt | HMDB | | DHC | HMDB | | 3,4-Dihydroxyhydrocinnamic acid | HMDB | | 3-(3',4'-Dihydroxyphenyl)propanoic acid | HMDB |
|
|---|
| Chemical Formula | C9H10O4 |
|---|
| Average Molecular Weight | 182.1733 |
|---|
| Monoisotopic Molecular Weight | 182.057908808 |
|---|
| IUPAC Name | 3-(3,4-dihydroxyphenyl)propanoic acid |
|---|
| Traditional Name | dihydrocaffeic acid |
|---|
| CAS Registry Number | 1078-61-1 |
|---|
| SMILES | OC(=O)CCC1=CC(O)=C(O)C=C1 |
|---|
| InChI Identifier | InChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13) |
|---|
| InChI Key | DZAUWHJDUNRCTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as phenylpropanoic acids. Phenylpropanoic acids are compounds with a structure containing a benzene ring conjugated to a propanoic acid. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Phenylpropanoic acids |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Phenylpropanoic acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - 3-phenylpropanoic-acid
- Catechol
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Phenol
- Monocyclic benzene moiety
- Benzenoid
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Organooxygen compound
- Hydrocarbon derivative
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 136 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 428 mg/mL | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|